C14H19N3O3S — CID 148630570
(3S,6S)-6-(hydroxymethyl)-3-methyl-N-prop-2-enoxy-5-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 148630570) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is (3S,6S)-6-(hydroxymethyl)-3-methyl-N-prop-2-enoxy-5-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | (3S,6S)-6-(hydroxymethyl)-3-methyl-N-prop-2-enoxy-5-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 148630570 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3S,6S)-6-(hydroxymethyl)-3-methyl-N-prop-2-enoxy-5-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | C=CCONC(=O)N1C[C@@H](C)C=C(c2nccs2)[C@H]1CO |
| InChI | InChI=1S/C14H19N3O3S/c1-3-5-20-16-14(19)17-8-10(2)7-11(12(17)9-18)13-15-4-6-21-13/h3-4,6-7,10,12,18H,1,5,8-9H2,2H3,(H,16,19)/t10-,12+/m0/s1 |
| InChIKey | NIBGJHXWCWPNRZ-CMPLNLGQSA-N |
| XLogP | 1.67 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|