C15H12BrF3N2O4S — CID 148661619
5-[[5-bromo-2-(trifluoromethoxy)phenyl]sulfonylmethyl]-N-methylpyridine-3-carboxamide (PubChem CID 148661619) has the molecular formula C15H12BrF3N2O4S and a molecular weight of 453.24 g/mol. Its IUPAC name is 5-[[5-bromo-2-(trifluoromethoxy)phenyl]sulfonylmethyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[[5-bromo-2-(trifluoromethoxy)phenyl]sulfonylmethyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 148661619 |
| Molecular Formula | C15H12BrF3N2O4S |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 5-[[5-bromo-2-(trifluoromethoxy)phenyl]sulfonylmethyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(CS(=O)(=O)c2cc(Br)ccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H12BrF3N2O4S/c1-20-14(22)10-4-9(6-21-7-10)8-26(23,24)13-5-11(16)2-3-12(13)25-15(17,18)19/h2-7H,8H2,1H3,(H,20,22) |
| InChIKey | NNXACHOUBATLRG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |