C19H15F3N2O4S — CID 157422960
3-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylmethyl]-5-pyridin-2-ylpyridine (PubChem CID 157422960) has the molecular formula C19H15F3N2O4S and a molecular weight of 424.40 g/mol. Its IUPAC name is 3-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylmethyl]-5-pyridin-2-ylpyridine.
| Compound Name | 3-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylmethyl]-5-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 157422960 |
| Molecular Formula | C19H15F3N2O4S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylmethyl]-5-pyridin-2-ylpyridine |
| SMILES | COc1ccc(OC(F)(F)F)cc1S(=O)(=O)Cc1cncc(-c2ccccn2)c1 |
| InChI | InChI=1S/C19H15F3N2O4S/c1-27-17-6-5-15(28-19(20,21)22)9-18(17)29(25,26)12-13-8-14(11-23-10-13)16-4-2-3-7-24-16/h2-11H,12H2,1H3 |
| InChIKey | PPMPZLNZLKIYPN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |