C20H21NO7S2 — CID 157350617
[3-[(2,5-dimethoxyphenyl)sulfonylmethyl]quinolin-6-yl]methyl methanesulfonate (PubChem CID 157350617) has the molecular formula C20H21NO7S2 and a molecular weight of 451.52 g/mol. Its IUPAC name is [3-[(2,5-dimethoxyphenyl)sulfonylmethyl]quinolin-6-yl]methyl methanesulfonate.
| Compound Name | [3-[(2,5-dimethoxyphenyl)sulfonylmethyl]quinolin-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 157350617 |
| Molecular Formula | C20H21NO7S2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [3-[(2,5-dimethoxyphenyl)sulfonylmethyl]quinolin-6-yl]methyl methanesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Cc2cnc3ccc(COS(C)(=O)=O)cc3c2)c1 |
| InChI | InChI=1S/C20H21NO7S2/c1-26-17-5-7-19(27-2)20(10-17)30(24,25)13-15-9-16-8-14(12-28-29(3,22)23)4-6-18(16)21-11-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | XPTKNHLDNGFQGX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|