C16H24 — CID 148801538
7,8-ditert-butylbicyclo[2.2.2]octa-1,3,5-triene (PubChem CID 148801538) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 7,8-ditert-butylbicyclo[2.2.2]octa-1,3,5-triene.
| Compound Name | 7,8-ditert-butylbicyclo[2.2.2]octa-1,3,5-triene |
|---|---|
| PubChem CID | 148801538 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 7,8-ditert-butylbicyclo[2.2.2]octa-1,3,5-triene |
| SMILES | CC(C)(C)C1c2ccc(cc2)C1C(C)(C)C |
| InChI | InChI=1S/C16H24/c1-15(2,3)13-11-7-9-12(10-8-11)14(13)16(4,5)6/h7-10,13-14H,1-6H3 |
| InChIKey | OOCVYAUGFLCCJA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |