C16H28O3 — CID 148807260
4-ethyl-4-(4-ethylcyclohexa-1,5-dien-1-yl)oxyhexane-1,2-diol (PubChem CID 148807260) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-ethyl-4-(4-ethylcyclohexa-1,5-dien-1-yl)oxyhexane-1,2-diol.
| Compound Name | 4-ethyl-4-(4-ethylcyclohexa-1,5-dien-1-yl)oxyhexane-1,2-diol |
|---|---|
| PubChem CID | 148807260 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 4-ethyl-4-(4-ethylcyclohexa-1,5-dien-1-yl)oxyhexane-1,2-diol |
| SMILES | CCC1C=CC(OC(CC)(CC)CC(O)CO)=CC1 |
| InChI | InChI=1S/C16H28O3/c1-4-13-7-9-15(10-8-13)19-16(5-2,6-3)11-14(18)12-17/h7,9-10,13-14,17-18H,4-6,8,11-12H2,1-3H3 |
| InChIKey | OPFBCDIBPYTTSX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |