C8H10N2O5 — CID 148887075
2-methoxy-2-(1H-pyrazol-5-ylmethyl)propanedioic acid (PubChem CID 148887075) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-methoxy-2-(1H-pyrazol-5-ylmethyl)propanedioic acid.
| Compound Name | 2-methoxy-2-(1H-pyrazol-5-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 148887075 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-methoxy-2-(1H-pyrazol-5-ylmethyl)propanedioic acid |
| SMILES | COC(Cc1ccn[nH]1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10N2O5/c1-15-8(6(11)12,7(13)14)4-5-2-3-9-10-5/h2-3H,4H2,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | PEELEKBMQXOBPK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|