C20H26ClNO7 — CID 14890649
tert-butyl (4aR,7S,8R,8aR)-8-(2-chloroacetyl)oxy-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 14890649) has the molecular formula C20H26ClNO7 and a molecular weight of 427.88 g/mol. Its IUPAC name is tert-butyl (4aR,7S,8R,8aR)-8-(2-chloroacetyl)oxy-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4aR,7S,8R,8aR)-8-(2-chloroacetyl)oxy-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 14890649 |
| Molecular Formula | C20H26ClNO7 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | tert-butyl (4aR,7S,8R,8aR)-8-(2-chloroacetyl)oxy-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)[C@@H](OC(=O)CCl)[C@@H]2OC(c3ccccc3)OC[C@H]21 |
| InChI | InChI=1S/C20H26ClNO7/c1-20(2,3)29-19(25)22-10-14(23)17(27-15(24)9-21)16-13(22)11-26-18(28-16)12-7-5-4-6-8-12/h4-8,13-14,16-18,23H,9-11H2,1-3H3/t13-,14+,16-,17-,18?/m1/s1 |
| InChIKey | KXZDRXCRELOTFH-KXLLVGMESA-N |
| XLogP | 2.23 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|