C22H22F4O4S — CID 148947887
4-(3-cyclononylbenzoyl)-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 148947887) has the molecular formula C22H22F4O4S and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-(3-cyclononylbenzoyl)-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(3-cyclononylbenzoyl)-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 148947887 |
| Molecular Formula | C22H22F4O4S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-(3-cyclononylbenzoyl)-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | O=C(c1cccc(C2CCCCCCCC2)c1)c1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C22H22F4O4S/c23-17-16(18(24)20(26)22(19(17)25)31(28,29)30)21(27)15-11-7-10-14(12-15)13-8-5-3-1-2-4-6-9-13/h7,10-13H,1-6,8-9H2,(H,28,29,30) |
| InChIKey | PPHGVINOTDRJSF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|