C22H22N6O4S — CID 1489654
N-[1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-nitrobenzenesulfonamide (PubChem CID 1489654) has the molecular formula C22H22N6O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 1489654 |
| Molecular Formula | C22H22N6O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-[1-tert-butyl-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(-c2nn(C(C)(C)C)c3ncnc(NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)c23)cc1 |
| InChI | InChI=1S/C22H22N6O4S/c1-14-5-7-15(8-6-14)19-18-20(23-13-24-21(18)27(25-19)22(2,3)4)26-33(31,32)17-11-9-16(10-12-17)28(29)30/h5-13H,1-4H3,(H,23,24,26) |
| InChIKey | KJEPYMRAOUQKRE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|