C19H36N2O3 — CID 148994204
N-[(4S,7R)-8-methyl-4-(2-methylpropanoyl)-6-oxo-7-(propan-2-ylamino)nonyl]acetamide (PubChem CID 148994204) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[(4S,7R)-8-methyl-4-(2-methylpropanoyl)-6-oxo-7-(propan-2-ylamino)nonyl]acetamide.
| Compound Name | N-[(4S,7R)-8-methyl-4-(2-methylpropanoyl)-6-oxo-7-(propan-2-ylamino)nonyl]acetamide |
|---|---|
| PubChem CID | 148994204 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | N-[(4S,7R)-8-methyl-4-(2-methylpropanoyl)-6-oxo-7-(propan-2-ylamino)nonyl]acetamide |
| SMILES | CC(=O)NCCC[C@@H](CC(=O)[C@H](NC(C)C)C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C19H36N2O3/c1-12(2)18(21-14(5)6)17(23)11-16(19(24)13(3)4)9-8-10-20-15(7)22/h12-14,16,18,21H,8-11H2,1-7H3,(H,20,22)/t16-,18+/m0/s1 |
| InChIKey | PYHAYDYIXNCKEI-FUHWJXTLSA-N |
| XLogP | 2.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|