C15H11NOSSe — CID 14900592
2-(1,3-benzothiazol-2-ylselanyl)-1-phenylethanone (PubChem CID 14900592) has the molecular formula C15H11NOSSe and a molecular weight of 332.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylselanyl)-1-phenylethanone.
| Compound Name | 2-(1,3-benzothiazol-2-ylselanyl)-1-phenylethanone |
|---|---|
| PubChem CID | 14900592 |
| Molecular Formula | C15H11NOSSe |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylselanyl)-1-phenylethanone |
| SMILES | O=C(C[Se]c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H11NOSSe/c17-13(11-6-2-1-3-7-11)10-19-15-16-12-8-4-5-9-14(12)18-15/h1-9H,10H2 |
| InChIKey | NUHCJOVLMOZGND-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|