C19H17F2NOS — CID 164673920
(4S)-4-(1,3-benzothiazol-2-yl)-6,6-difluoro-1-phenylhexan-1-one (PubChem CID 164673920) has the molecular formula C19H17F2NOS and a molecular weight of 345.41 g/mol. Its IUPAC name is (4S)-4-(1,3-benzothiazol-2-yl)-6,6-difluoro-1-phenylhexan-1-one.
| Compound Name | (4S)-4-(1,3-benzothiazol-2-yl)-6,6-difluoro-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 164673920 |
| Molecular Formula | C19H17F2NOS |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (4S)-4-(1,3-benzothiazol-2-yl)-6,6-difluoro-1-phenylhexan-1-one |
| SMILES | O=C(CC[C@@H](CC(F)F)c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C19H17F2NOS/c20-18(21)12-14(10-11-16(23)13-6-2-1-3-7-13)19-22-15-8-4-5-9-17(15)24-19/h1-9,14,18H,10-12H2/t14-/m0/s1 |
| InChIKey | QXUIBTNKHVKJQU-AWEZNQCLSA-N |
| XLogP | 5.70 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |