C13H13ClS — CID 14900854
(1R,3S,4S)-3-(4-chlorophenyl)-2-thiabicyclo[2.2.2]oct-5-ene (PubChem CID 14900854) has the molecular formula C13H13ClS and a molecular weight of 236.77 g/mol. Its IUPAC name is (1R,3S,4S)-3-(4-chlorophenyl)-2-thiabicyclo[2.2.2]oct-5-ene.
| Compound Name | (1R,3S,4S)-3-(4-chlorophenyl)-2-thiabicyclo[2.2.2]oct-5-ene |
|---|---|
| PubChem CID | 14900854 |
| Molecular Formula | C13H13ClS |
| Molecular Weight | 236.77 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (1R,3S,4S)-3-(4-chlorophenyl)-2-thiabicyclo[2.2.2]oct-5-ene |
| SMILES | Clc1ccc([C@H]2S[C@H]3C=C[C@@H]2CC3)cc1 |
| InChI | InChI=1S/C13H13ClS/c14-11-5-1-9(2-6-11)13-10-3-7-12(15-13)8-4-10/h1-3,5-7,10,12-13H,4,8H2/t10-,12+,13-/m1/s1 |
| InChIKey | RZZSBPUNYHKHMP-KGYLQXTDSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|