C19H19FN4O5S — CID 149020761
2-fluoro-4-[2-hydroxy-3-[(6-isocyano-5-methyl-3-pyridinyl)amino]-2-methyl-3-oxopropyl]sulfonyl-N-methylbenzamide (PubChem CID 149020761) has the molecular formula C19H19FN4O5S and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-fluoro-4-[2-hydroxy-3-[(6-isocyano-5-methyl-3-pyridinyl)amino]-2-methyl-3-oxopropyl]sulfonyl-N-methylbenzamide.
| Compound Name | 2-fluoro-4-[2-hydroxy-3-[(6-isocyano-5-methyl-3-pyridinyl)amino]-2-methyl-3-oxopropyl]sulfonyl-N-methylbenzamide |
|---|---|
| PubChem CID | 149020761 |
| Molecular Formula | C19H19FN4O5S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-fluoro-4-[2-hydroxy-3-[(6-isocyano-5-methyl-3-pyridinyl)amino]-2-methyl-3-oxopropyl]sulfonyl-N-methylbenzamide |
| SMILES | [C-]#[N+]c1ncc(NC(=O)C(C)(O)CS(=O)(=O)c2ccc(C(=O)NC)c(F)c2)cc1C |
| InChI | InChI=1S/C19H19FN4O5S/c1-11-7-12(9-23-16(11)21-3)24-18(26)19(2,27)10-30(28,29)13-5-6-14(15(20)8-13)17(25)22-4/h5-9,27H,10H2,1-2,4H3,(H,22,25)(H,24,26) |
| InChIKey | QDKOEDDWAVJEGH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 129.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|