C18H19N3O4S — CID 149294243
(2R)-2-hydroxy-N-(5-isocyano-4-methyl-2-pyridinyl)-2-methyl-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 149294243) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-(5-isocyano-4-methyl-2-pyridinyl)-2-methyl-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | (2R)-2-hydroxy-N-(5-isocyano-4-methyl-2-pyridinyl)-2-methyl-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 149294243 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2R)-2-hydroxy-N-(5-isocyano-4-methyl-2-pyridinyl)-2-methyl-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | [C-]#[N+]c1cnc(NC(=O)[C@@](C)(O)CS(=O)(=O)c2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C18H19N3O4S/c1-12-5-7-14(8-6-12)26(24,25)11-18(3,23)17(22)21-16-9-13(2)15(19-4)10-20-16/h5-10,23H,11H2,1-3H3,(H,20,21,22)/t18-/m0/s1 |
| InChIKey | XVLRENYHRBOCCY-SFHVURJKSA-N |
| XLogP | 2.41 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|