C11H17I — CID 149048580
9-iodotricyclo[6.2.1.02,7]undecane (PubChem CID 149048580) has the molecular formula C11H17I and a molecular weight of 276.16 g/mol. Its IUPAC name is 9-iodotricyclo[6.2.1.02,7]undecane.
| Compound Name | 9-iodotricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 149048580 |
| Molecular Formula | C11H17I |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 9-iodotricyclo[6.2.1.02,7]undecane |
| SMILES | IC1CC2CC1C1CCCCC21 |
| InChI | InChI=1S/C11H17I/c12-11-6-7-5-10(11)9-4-2-1-3-8(7)9/h7-11H,1-6H2 |
| InChIKey | QJJGAVFPJBQIBI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|