About aziridin-2-yl(dimethyl)-λ3-iodane
aziridin-2-yl(dimethyl)-λ3-iodane (PubChem CID 149054738) has the molecular formula C4H10IN
and a molecular weight of 199.03 g/mol. Its IUPAC name is aziridin-2-yl(dimethyl)-λ3-iodane.
Molecular Properties
| Compound Name | aziridin-2-yl(dimethyl)-λ3-iodane |
| PubChem CID | 149054738 |
| Molecular Formula | C4H10IN |
| Molecular Weight | 199.03 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | aziridin-2-yl(dimethyl)-λ3-iodane |
| SMILES | CI(C)C1CN1 |
| InChI | InChI=1S/C4H10IN/c1-5(2)4-3-6-4/h4,6H,3H2,1-2H3 |
| InChIKey | QKNBSCWQVORBCS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.03 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-2-yl(dimethyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-2-yl(dimethyl)-λ3-iodane?
The IUPAC name of aziridin-2-yl(dimethyl)-λ3-iodane (CID 149054738) is aziridin-2-yl(dimethyl)-λ3-iodane.
What is the SMILES notation for aziridin-2-yl(dimethyl)-λ3-iodane?
The canonical SMILES for aziridin-2-yl(dimethyl)-λ3-iodane is CI(C)C1CN1.
What is the InChIKey of aziridin-2-yl(dimethyl)-λ3-iodane?
The InChIKey is QKNBSCWQVORBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10IN/c1-5(2)4-3-6-4/h4,6H,3H2,1-2H3.
What are the key properties of aziridin-2-yl(dimethyl)-λ3-iodane?
aziridin-2-yl(dimethyl)-λ3-iodane has a molecular weight of 199.03 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-2-yl(dimethyl)-λ3-iodane is sourced from PubChem (CID 149054738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).