C27H37N7 — CID 149056967
1-N,3-N-bis[1-(4-piperazin-1-ylphenyl)ethylidene]propane-1,2,3-triimine (PubChem CID 149056967) has the molecular formula C27H37N7 and a molecular weight of 459.64 g/mol. Its IUPAC name is 1-N,3-N-bis[1-(4-piperazin-1-ylphenyl)ethylidene]propane-1,2,3-triimine.
| Compound Name | 1-N,3-N-bis[1-(4-piperazin-1-ylphenyl)ethylidene]propane-1,2,3-triimine |
|---|---|
| PubChem CID | 149056967 |
| Molecular Formula | C27H37N7 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 1-N,3-N-bis[1-(4-piperazin-1-ylphenyl)ethylidene]propane-1,2,3-triimine |
| SMILES | [H]N=C(C/N=C(\C)c1ccc(N2CCNCC2)cc1)C/N=C(\C)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C27H37N7/c1-21(23-3-7-26(8-4-23)33-15-11-29-12-16-33)31-19-25(28)20-32-22(2)24-5-9-27(10-6-24)34-17-13-30-14-18-34/h3-10,28-30H,11-20H2,1-2H3/b31-21+,32-22+ |
| InChIKey | QLAMCTHSZUYUIP-RWRHWQIFSA-N |
| XLogP | 2.84 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|