About CID 149072943
CID 149072943 (PubChem CID 149072943) has the molecular formula C15H25NOSi-
and a molecular weight of 263.46 g/mol.
Molecular Properties
| Compound Name | CID 149072943 |
| PubChem CID | 149072943 |
| Molecular Formula | C15H25NOSi- |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | — |
| SMILES | CC(=O)N(C)c1cccc([Si-](C)(C)CC(C)C)c1 |
| InChI | InChI=1S/C15H25NOSi/c1-12(2)11-18(5,6)15-9-7-8-14(10-15)16(4)13(3)17/h7-10,12H,11H2,1-6H3/q-1 |
| InChIKey | KYXZLUFBIPFOQD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 149072943 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149072943?
The IUPAC name of CID 149072943 (CID 149072943) is not available.
What is the SMILES notation for CID 149072943?
The canonical SMILES for CID 149072943 is CC(=O)N(C)c1cccc([Si-](C)(C)CC(C)C)c1.
What is the InChIKey of CID 149072943?
The InChIKey is KYXZLUFBIPFOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NOSi/c1-12(2)11-18(5,6)15-9-7-8-14(10-15)16(4)13(3)17/h7-10,12H,11H2,1-6H3/q-1.
What are the key properties of CID 149072943?
CID 149072943 has a molecular weight of 263.46 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149072943 is sourced from PubChem (CID 149072943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).