C21H25N3O6 — CID 149095083
5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)pentyl N-(3-nitrophenyl)carbamate (PubChem CID 149095083) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)pentyl N-(3-nitrophenyl)carbamate.
| Compound Name | 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)pentyl N-(3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 149095083 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)pentyl N-(3-nitrophenyl)carbamate |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)OCCCCCN1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C21H25N3O6/c25-19-17-13-7-8-14(11-13)18(17)20(26)23(19)9-2-1-3-10-30-21(27)22-15-5-4-6-16(12-15)24(28)29/h4-6,12-14,17-18H,1-3,7-11H2,(H,22,27) |
| InChIKey | GBGUQZXATWULTB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|