C25H34BF3N4O4 — CID 149134540
5-tert-butyl-N-[(5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 149134540) has the molecular formula C25H34BF3N4O4 and a molecular weight of 522.38 g/mol. Its IUPAC name is 5-tert-butyl-N-[(5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 149134540 |
| Molecular Formula | C25H34BF3N4O4 |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 5-tert-butyl-N-[(5R)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CC(C)(C)c1nc(C(=O)N[C@@H]2CCN(CC(F)(F)F)Cc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)no1 |
| InChI | InChI=1S/C25H34BF3N4O4/c1-22(2,3)21-31-19(32-35-21)20(34)30-18-10-11-33(14-25(27,28)29)13-15-12-16(8-9-17(15)18)26-36-23(4,5)24(6,7)37-26/h8-9,12,18H,10-11,13-14H2,1-7H3,(H,30,34)/t18-/m1/s1 |
| InChIKey | RDUSASFBNYTOIA-GOSISDBHSA-N |
| XLogP | 3.91 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|