C12H19ClN2O3 — CID 149162336
tert-butyl N-[3-chloro-6-(1-hydroxyethyl)-2H-pyridin-3-yl]carbamate (PubChem CID 149162336) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is tert-butyl N-[3-chloro-6-(1-hydroxyethyl)-2H-pyridin-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-chloro-6-(1-hydroxyethyl)-2H-pyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 149162336 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | tert-butyl N-[3-chloro-6-(1-hydroxyethyl)-2H-pyridin-3-yl]carbamate |
| SMILES | CC(O)C1=NCC(Cl)(NC(=O)OC(C)(C)C)C=C1 |
| InChI | InChI=1S/C12H19ClN2O3/c1-8(16)9-5-6-12(13,7-14-9)15-10(17)18-11(2,3)4/h5-6,8,16H,7H2,1-4H3,(H,15,17) |
| InChIKey | VALAJAFUZSWLGY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|