C25H21ClN4O4 — CID 1492052
N'-[(2-chlorophenyl)methyl]-6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide (PubChem CID 1492052) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is N'-[(2-chlorophenyl)methyl]-6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide.
| Compound Name | N'-[(2-chlorophenyl)methyl]-6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 1492052 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N'-[(2-chlorophenyl)methyl]-6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide |
| SMILES | COc1ccc(-n2c(O)c(/C(=N/Cc3ccccc3Cl)Nc3ccccc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H21ClN4O4/c1-34-19-13-11-18(12-14-19)30-24(32)21(23(31)29-25(30)33)22(28-17-8-3-2-4-9-17)27-15-16-7-5-6-10-20(16)26/h2-14,32H,15H2,1H3,(H,27,28)(H,29,31,33) |
| InChIKey | QXTBYCXUKCNTCC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|