C32H24F3N3O3 — CID 149208185
1-[1-[2-[4-[5-(3-amino-4-fluorophenyl)pyrrolo[1,2-b]pyridazin-4-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 149208185) has the molecular formula C32H24F3N3O3 and a molecular weight of 555.56 g/mol. Its IUPAC name is 1-[1-[2-[4-[5-(3-amino-4-fluorophenyl)pyrrolo[1,2-b]pyridazin-4-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[4-[5-(3-amino-4-fluorophenyl)pyrrolo[1,2-b]pyridazin-4-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 149208185 |
| Molecular Formula | C32H24F3N3O3 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 1-[1-[2-[4-[5-(3-amino-4-fluorophenyl)pyrrolo[1,2-b]pyridazin-4-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | Nc1cc(-c2ccn3nccc(Oc4ccc(CC(=O)C5(C(=O)Cc6ccc(F)cc6)CC5)cc4F)c23)ccc1F |
| InChI | InChI=1S/C32H24F3N3O3/c33-22-5-1-19(2-6-22)16-29(39)32(11-12-32)30(40)17-20-3-8-27(25(35)15-20)41-28-9-13-37-38-14-10-23(31(28)38)21-4-7-24(34)26(36)18-21/h1-10,13-15,18H,11-12,16-17,36H2 |
| InChIKey | XGASCCHNBZRRQL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|