C32H51N4O4Si2 — CID 149225342
CID 149225342 (PubChem CID 149225342) has the molecular formula C32H51N4O4Si2 and a molecular weight of 611.96 g/mol.
| Compound Name | CID 149225342 |
|---|---|
| PubChem CID | 149225342 |
| Molecular Formula | C32H51N4O4Si2 |
| Molecular Weight | 611.96 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | — |
| SMILES | CC(CO)NC(=O)c1ccc2cc(-c3nn(COCC[Si](C)(C)C)c4c3CCC(C)(C)C4)n(COCC[Si](C)C)c2c1 |
| InChI | InChI=1S/C32H51N4O4Si2/c1-23(20-37)33-31(38)25-10-9-24-17-28(35(27(24)18-25)21-39-13-15-41(4)5)30-26-11-12-32(2,3)19-29(26)36(34-30)22-40-14-16-42(6,7)8/h9-10,17-18,23,37H,11-16,19-22H2,1-8H3,(H,33,38) |
| InChIKey | FHQSRPQUAPTZQR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|