C24H30F2N4O3Si — CID 171441664
methyl 2-[5,5-difluoro-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4a,6-dihydro-4H-cyclopropa[f]indazol-3-yl]-3H-benzimidazole-5-carboxylate (PubChem CID 171441664) has the molecular formula C24H30F2N4O3Si and a molecular weight of 488.61 g/mol. Its IUPAC name is methyl 2-[5,5-difluoro-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4a,6-dihydro-4H-cyclopropa[f]indazol-3-yl]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[5,5-difluoro-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4a,6-dihydro-4H-cyclopropa[f]indazol-3-yl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 171441664 |
| Molecular Formula | C24H30F2N4O3Si |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | methyl 2-[5,5-difluoro-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4a,6-dihydro-4H-cyclopropa[f]indazol-3-yl]-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3nn(COCC[Si](C)(C)C)c4c3CC3C(F)(F)C3(C)C4)[nH]c2c1 |
| InChI | InChI=1S/C24H30F2N4O3Si/c1-23-12-18-15(11-19(23)24(23,25)26)20(29-30(18)13-33-8-9-34(3,4)5)21-27-16-7-6-14(22(31)32-2)10-17(16)28-21/h6-7,10,19H,8-9,11-13H2,1-5H3,(H,27,28) |
| InChIKey | CAIRBVUENCLTKU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|