C17H24N3O+ — CID 149295672
2-(2-methylbutan-2-yliminomethyl)-4-[(3-methylimidazol-3-ium-1-yl)methyl]phenol (PubChem CID 149295672) has the molecular formula C17H24N3O+ and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yliminomethyl)-4-[(3-methylimidazol-3-ium-1-yl)methyl]phenol.
| Compound Name | 2-(2-methylbutan-2-yliminomethyl)-4-[(3-methylimidazol-3-ium-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 149295672 |
| Molecular Formula | C17H24N3O+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-(2-methylbutan-2-yliminomethyl)-4-[(3-methylimidazol-3-ium-1-yl)methyl]phenol |
| SMILES | CCC(C)(C)/N=C/c1cc(Cn2cc[n+](C)c2)ccc1O |
| InChI | InChI=1S/C17H23N3O/c1-5-17(2,3)18-11-15-10-14(6-7-16(15)21)12-20-9-8-19(4)13-20/h6-11,13H,5,12H2,1-4H3/p+1 |
| InChIKey | FJOUGJKYYGZYAK-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 41.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|