C15H15N3O3 — CID 1493598
(2E)-2-[(2-nitrophenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one (PubChem CID 1493598) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2E)-2-[(2-nitrophenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one.
| Compound Name | (2E)-2-[(2-nitrophenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 1493598 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2E)-2-[(2-nitrophenyl)methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
| SMILES | O=C1/C(=C\c2ccccc2[N+](=O)[O-])N=C2CCCCCN12 |
| InChI | InChI=1S/C15H15N3O3/c19-15-12(16-14-8-2-1-5-9-17(14)15)10-11-6-3-4-7-13(11)18(20)21/h3-4,6-7,10H,1-2,5,8-9H2/b12-10+ |
| InChIKey | ALHMKCSDJCKWFG-ZRDIBKRKSA-N |
| XLogP | 2.75 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|