C8H13BO3 — CID 149371853
[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid (PubChem CID 149371853) has the molecular formula C8H13BO3 and a molecular weight of 168.00 g/mol. Its IUPAC name is [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid.
| Compound Name | [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 149371853 |
| Molecular Formula | C8H13BO3 |
| Molecular Weight | 168.00 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid |
| SMILES | CCC1=C(B(O)O)[C@H](O)CC=C1 |
| InChI | InChI=1S/C8H13BO3/c1-2-6-4-3-5-7(10)8(6)9(11)12/h3-4,7,10-12H,2,5H2,1H3/t7-/m1/s1 |
| InChIKey | YJYQTWQOMWOOIG-SSDOTTSWSA-N |
| XLogP | 0.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.00 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|