[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid

C8H13BO3 — CID 149371853

IUPAC[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid
SMILESCCC1=C(B(O)O)[C@H](O)CC=C1
InChIInChI=1S/C8H13BO3/c1-2-6-4-3-5-7(10)8(6)9(11)12/h3-4,7,10-12H,2,5H2,1H3/t7-/m1/s1
InChIKeyYJYQTWQOMWOOIG-SSDOTTSWSA-N
MW168.00 g/mol
LogP0.03
Rot. Bonds2

About [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid

[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid (PubChem CID 149371853) has the molecular formula C8H13BO3 and a molecular weight of 168.00 g/mol. Its IUPAC name is [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid.

Molecular Properties

Compound Name[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid
PubChem CID149371853
Molecular FormulaC8H13BO3
Molecular Weight168.00 g/mol
Exact Mass168.10
IUPAC Name[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid
SMILESCCC1=C(B(O)O)[C@H](O)CC=C1
InChIInChI=1S/C8H13BO3/c1-2-6-4-3-5-7(10)8(6)9(11)12/h3-4,7,10-12H,2,5H2,1H3/t7-/m1/s1
InChIKeyYJYQTWQOMWOOIG-SSDOTTSWSA-N
XLogP0.03
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.00
LogP ≤ 50.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid?
The IUPAC name of [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid (CID 149371853) is [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid.
What is the SMILES notation for [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid?
The canonical SMILES for [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid is CCC1=C(B(O)O)[C@H](O)CC=C1.
What is the InChIKey of [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid?
The InChIKey is YJYQTWQOMWOOIG-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13BO3/c1-2-6-4-3-5-7(10)8(6)9(11)12/h3-4,7,10-12H,2,5H2,1H3/t7-/m1/s1.
What are the key properties of [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid?
[(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid has a molecular weight of 168.00 g/mol, XLogP of 0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-2-ethyl-6-hydroxycyclohexa-1,3-dien-1-yl]boronic acid is sourced from PubChem (CID 149371853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).