C23H30F3N3O2 — CID 149389344
N-[4-[2-[4-(3-acetylphenyl)piperazin-1-yl]ethyl]cyclohexylidene]-3,3,3-trifluoropropanamide (PubChem CID 149389344) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is N-[4-[2-[4-(3-acetylphenyl)piperazin-1-yl]ethyl]cyclohexylidene]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-[2-[4-(3-acetylphenyl)piperazin-1-yl]ethyl]cyclohexylidene]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 149389344 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[4-[2-[4-(3-acetylphenyl)piperazin-1-yl]ethyl]cyclohexylidene]-3,3,3-trifluoropropanamide |
| SMILES | CC(=O)c1cccc(N2CCN(CCC3CCC(=NC(=O)CC(F)(F)F)CC3)CC2)c1 |
| InChI | InChI=1S/C23H30F3N3O2/c1-17(30)19-3-2-4-21(15-19)29-13-11-28(12-14-29)10-9-18-5-7-20(8-6-18)27-22(31)16-23(24,25)26/h2-4,15,18H,5-14,16H2,1H3/b27-20- |
| InChIKey | YNFIFYLCNWAOHE-OOAXWGSJSA-N |
| XLogP | 4.51 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|