C21H27F4N3O — CID 162564557
3,3,3-trifluoro-N-[4-[2-[4-(3-fluorophenyl)piperazin-1-yl]ethyl]cyclohexylidene]propanamide (PubChem CID 162564557) has the molecular formula C21H27F4N3O and a molecular weight of 413.46 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[4-[2-[4-(3-fluorophenyl)piperazin-1-yl]ethyl]cyclohexylidene]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[4-[2-[4-(3-fluorophenyl)piperazin-1-yl]ethyl]cyclohexylidene]propanamide |
|---|---|
| PubChem CID | 162564557 |
| Molecular Formula | C21H27F4N3O |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3,3,3-trifluoro-N-[4-[2-[4-(3-fluorophenyl)piperazin-1-yl]ethyl]cyclohexylidene]propanamide |
| SMILES | O=C(CC(F)(F)F)N=C1CCC(CCN2CCN(c3cccc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H27F4N3O/c22-17-2-1-3-19(14-17)28-12-10-27(11-13-28)9-8-16-4-6-18(7-5-16)26-20(29)15-21(23,24)25/h1-3,14,16H,4-13,15H2/b26-18- |
| InChIKey | UCDOYDKXRNWEDD-ITYLOYPMSA-N |
| XLogP | 4.45 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|