C13H10Y-2 — CID 149419186
cyclohexa-2,5-dien-1-ylidenemethylbenzene;yttrium (PubChem CID 149419186) has the molecular formula C13H10Y-2 and a molecular weight of 255.13 g/mol. Its IUPAC name is cyclohexa-2,5-dien-1-ylidenemethylbenzene;yttrium.
| Compound Name | cyclohexa-2,5-dien-1-ylidenemethylbenzene;yttrium |
|---|---|
| PubChem CID | 149419186 |
| Molecular Formula | C13H10Y-2 |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | cyclohexa-2,5-dien-1-ylidenemethylbenzene;yttrium |
| SMILES | [C-]1=CCC=CC1=Cc1[c-]cccc1.[Y] |
| InChI | InChI=1S/C13H10.Y/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-7,9,11H,2H2;/q-2; |
| InChIKey | FNEKVINGXYTNFI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|