C9H11N3 — CID 149422163
3-cyclohexa-2,4-dien-1-yl-1-methyl-1,2,4-triazole (PubChem CID 149422163) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-1-methyl-1,2,4-triazole.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 149422163 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-1-methyl-1,2,4-triazole |
| SMILES | Cn1cnc(C2C=CC=CC2)n1 |
| InChI | InChI=1S/C9H11N3/c1-12-7-10-9(11-12)8-5-3-2-4-6-8/h2-5,7-8H,6H2,1H3 |
| InChIKey | YTJUEXMNLVHJOO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |