C20H30N2O6 — CID 149433924
tert-butyl (3R,4R)-4-hydroxy-3-[methoxy-(4-methoxybenzoyl)amino]azepane-1-carboxylate (PubChem CID 149433924) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-hydroxy-3-[methoxy-(4-methoxybenzoyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-hydroxy-3-[methoxy-(4-methoxybenzoyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 149433924 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl (3R,4R)-4-hydroxy-3-[methoxy-(4-methoxybenzoyl)amino]azepane-1-carboxylate |
| SMILES | COc1ccc(C(=O)N(OC)[C@@H]2CN(C(=O)OC(C)(C)C)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C20H30N2O6/c1-20(2,3)28-19(25)21-12-6-7-17(23)16(13-21)22(27-5)18(24)14-8-10-15(26-4)11-9-14/h8-11,16-17,23H,6-7,12-13H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | XAIMRRDTLCYFPQ-IAGOWNOFSA-N |
| XLogP | 2.46 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|