C13H26O6Si — CID 149435766
ethenyl-diethoxy-(1,1,1-trimethoxybut-3-en-2-yloxy)silane (PubChem CID 149435766) has the molecular formula C13H26O6Si and a molecular weight of 306.43 g/mol. Its IUPAC name is ethenyl-diethoxy-(1,1,1-trimethoxybut-3-en-2-yloxy)silane.
| Compound Name | ethenyl-diethoxy-(1,1,1-trimethoxybut-3-en-2-yloxy)silane |
|---|---|
| PubChem CID | 149435766 |
| Molecular Formula | C13H26O6Si |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethenyl-diethoxy-(1,1,1-trimethoxybut-3-en-2-yloxy)silane |
| SMILES | C=CC(O[Si](C=C)(OCC)OCC)C(OC)(OC)OC |
| InChI | InChI=1S/C13H26O6Si/c1-8-12(13(14-5,15-6)16-7)19-20(11-4,17-9-2)18-10-3/h8,11-12H,1,4,9-10H2,2-3,5-7H3 |
| InChIKey | KVKQCXQAABXCHF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|