C20H38O2Si2 — CID 14944237
(4aS,5S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-trimethylsilyl-1,2,3,4,4a,5,8,9a-octahydrobenzo[7]annulen-9-one (PubChem CID 14944237) has the molecular formula C20H38O2Si2 and a molecular weight of 366.69 g/mol. Its IUPAC name is (4aS,5S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-trimethylsilyl-1,2,3,4,4a,5,8,9a-octahydrobenzo[7]annulen-9-one.
| Compound Name | (4aS,5S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-trimethylsilyl-1,2,3,4,4a,5,8,9a-octahydrobenzo[7]annulen-9-one |
|---|---|
| PubChem CID | 14944237 |
| Molecular Formula | C20H38O2Si2 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (4aS,5S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-trimethylsilyl-1,2,3,4,4a,5,8,9a-octahydrobenzo[7]annulen-9-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@H]([Si](C)(C)C)[C@H]2CCCC[C@H]2C(=O)C1 |
| InChI | InChI=1S/C20H38O2Si2/c1-20(2,3)24(7,8)22-15-13-18(21)16-11-9-10-12-17(16)19(14-15)23(4,5)6/h14,16-17,19H,9-13H2,1-8H3/t16-,17+,19-/m1/s1 |
| InChIKey | XQFRHOODYGRPDI-ZIFCJYIRSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|