C30H60O2SiSn — CID 10886532
(5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-pentyl-5-tributylstannylcyclohept-3-en-1-one (PubChem CID 10886532) has the molecular formula C30H60O2SiSn and a molecular weight of 599.61 g/mol. Its IUPAC name is (5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-pentyl-5-tributylstannylcyclohept-3-en-1-one.
| Compound Name | (5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-pentyl-5-tributylstannylcyclohept-3-en-1-one |
|---|---|
| PubChem CID | 10886532 |
| Molecular Formula | C30H60O2SiSn |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | (5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-pentyl-5-tributylstannylcyclohept-3-en-1-one |
| SMILES | CCCCC[C@@H]1CC(=O)CC(O[Si](C)(C)C(C)(C)C)=C[C@H]1[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H33O2Si.3C4H9.Sn/c1-7-8-9-10-15-11-12-17(14-16(19)13-15)20-21(5,6)18(2,3)4;3*1-3-4-2;/h11-12,15H,7-10,13-14H2,1-6H3;3*1,3-4H2,2H3;/t15-;;;;/m0..../s1 |
| InChIKey | SLZNOWFCQAOCJC-FWELSTJRSA-N |
| XLogP | 10.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|