C19H36O2Si2 — CID 11024606
(3aR,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-trimethylsilyl-2,3,3a,5,8,8a-hexahydro-1H-azulen-4-one (PubChem CID 11024606) has the molecular formula C19H36O2Si2 and a molecular weight of 352.67 g/mol. Its IUPAC name is (3aR,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-trimethylsilyl-2,3,3a,5,8,8a-hexahydro-1H-azulen-4-one.
| Compound Name | (3aR,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-trimethylsilyl-2,3,3a,5,8,8a-hexahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 11024606 |
| Molecular Formula | C19H36O2Si2 |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (3aR,8S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-trimethylsilyl-2,3,3a,5,8,8a-hexahydro-1H-azulen-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@H]([Si](C)(C)C)[C@H]2CCC[C@H]2C(=O)C1 |
| InChI | InChI=1S/C19H36O2Si2/c1-19(2,3)23(7,8)21-14-12-17(20)15-10-9-11-16(15)18(13-14)22(4,5)6/h13,15-16,18H,9-12H2,1-8H3/t15-,16+,18-/m1/s1 |
| InChIKey | IRBXGOOPQMGTAJ-SOLBZPMBSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|