C19H38O2Si2 — CID 15828747
(5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yl-5-trimethylsilylcyclohept-3-en-1-one (PubChem CID 15828747) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is (5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yl-5-trimethylsilylcyclohept-3-en-1-one.
| Compound Name | (5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yl-5-trimethylsilylcyclohept-3-en-1-one |
|---|---|
| PubChem CID | 15828747 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yl-5-trimethylsilylcyclohept-3-en-1-one |
| SMILES | CC(C)[C@H]1CC(=O)CC(O[Si](C)(C)C(C)(C)C)=C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-14(2)17-12-15(20)11-16(13-18(17)22(6,7)8)21-23(9,10)19(3,4)5/h13-14,17-18H,11-12H2,1-10H3/t17-,18+/m1/s1 |
| InChIKey | HVRMXSOJHRMKHR-MSOLQXFVSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|