C19H38O2Si2 — CID 14944231
(5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propyl-5-trimethylsilylcyclohept-3-en-1-one (PubChem CID 14944231) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is (5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propyl-5-trimethylsilylcyclohept-3-en-1-one.
| Compound Name | (5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propyl-5-trimethylsilylcyclohept-3-en-1-one |
|---|---|
| PubChem CID | 14944231 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propyl-5-trimethylsilylcyclohept-3-en-1-one |
| SMILES | CCC[C@H]1CC(=O)CC(O[Si](C)(C)C(C)(C)C)=C[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-10-11-15-12-16(20)13-17(14-18(15)22(5,6)7)21-23(8,9)19(2,3)4/h14-15,18H,10-13H2,1-9H3/t15-,18+/m0/s1 |
| InChIKey | LQQRUIDQKCNAEJ-MAUKXSAKSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|