C8H13N5S — CID 14953276
2-amino-6-piperidin-1-yl-1H-1,3,5-triazine-4-thione (PubChem CID 14953276) has the molecular formula C8H13N5S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-amino-6-piperidin-1-yl-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-piperidin-1-yl-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 14953276 |
| Molecular Formula | C8H13N5S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-amino-6-piperidin-1-yl-1H-1,3,5-triazine-4-thione |
| SMILES | Nc1nc(=S)nc(N2CCCCC2)[nH]1 |
| InChI | InChI=1S/C8H13N5S/c9-6-10-7(12-8(14)11-6)13-4-2-1-3-5-13/h1-5H2,(H3,9,10,11,12,14) |
| InChIKey | MSJMSRLREACDJP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|