C7H8FN5O3S2 — CID 168716227
1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168716227) has the molecular formula C7H8FN5O3S2 and a molecular weight of 293.31 g/mol. Its IUPAC name is 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168716227 |
| Molecular Formula | C7H8FN5O3S2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Nc1nc(=S)nc(N2CC(S(=O)(=O)F)CC2=O)[nH]1 |
| InChI | InChI=1S/C7H8FN5O3S2/c8-18(15,16)3-1-4(14)13(2-3)6-10-5(9)11-7(17)12-6/h3H,1-2H2,(H3,9,10,11,12,17) |
| InChIKey | GBFCDYBBLRQCDX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|