C11H13ClO2Te — CID 14953971
2-chloro-2-(4-ethoxyphenyl)-5H-1,2lambda4-oxatellurole (PubChem CID 14953971) has the molecular formula C11H13ClO2Te and a molecular weight of 340.28 g/mol. Its IUPAC name is 2-chloro-2-(4-ethoxyphenyl)-5H-1,2lambda4-oxatellurole.
| Compound Name | 2-chloro-2-(4-ethoxyphenyl)-5H-1,2lambda4-oxatellurole |
|---|---|
| PubChem CID | 14953971 |
| Molecular Formula | C11H13ClO2Te |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-chloro-2-(4-ethoxyphenyl)-5H-1,2lambda4-oxatellurole |
| SMILES | CCOc1ccc([Te]2(Cl)C=CCO2)cc1 |
| InChI | InChI=1S/C11H13ClO2Te/c1-2-13-10-4-6-11(7-5-10)15(12)9-3-8-14-15/h3-7,9H,2,8H2,1H3 |
| InChIKey | NRJRAEHFXWDLSE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|