C15H15ClN2O3 — CID 14963383
3-chloro-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]pyridazine (PubChem CID 14963383) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is 3-chloro-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]pyridazine.
| Compound Name | 3-chloro-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]pyridazine |
|---|---|
| PubChem CID | 14963383 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-chloro-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]pyridazine |
| SMILES | COc1cc(/C=C/c2ccc(Cl)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15ClN2O3/c1-19-12-8-10(9-13(20-2)15(12)21-3)4-5-11-6-7-14(16)18-17-11/h4-9H,1-3H3/b5-4+ |
| InChIKey | OJAUUAUXSIWZIX-SNAWJCMRSA-N |
| XLogP | 3.33 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |