C8H14F3NO2S — CID 14965465
1,1,1-trifluoro-N-(2-methylcyclohexyl)methanesulfonamide (PubChem CID 14965465) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(2-methylcyclohexyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(2-methylcyclohexyl)methanesulfonamide |
|---|---|
| PubChem CID | 14965465 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1,1,1-trifluoro-N-(2-methylcyclohexyl)methanesulfonamide |
| SMILES | CC1CCCCC1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2S/c1-6-4-2-3-5-7(6)12-15(13,14)8(9,10)11/h6-7,12H,2-5H2,1H3 |
| InChIKey | XDWCJCRRBDOTPP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |