C14H22O6Se — CID 14981289
(1R,2S,4S,5S,6S)-5-[[(1R,2R,3R,4S,5R)-5-hydroxy-3-methoxy-7-oxabicyclo[2.2.1]heptan-2-yl]selanyl]-6-methoxy-7-oxabicyclo[2.2.1]heptan-2-ol (PubChem CID 14981289) has the molecular formula C14H22O6Se and a molecular weight of 365.28 g/mol. Its IUPAC name is (1R,2S,4S,5S,6S)-5-[[(1R,2R,3R,4S,5R)-5-hydroxy-3-methoxy-7-oxabicyclo[2.2.1]heptan-2-yl]selanyl]-6-methoxy-7-oxabicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,4S,5S,6S)-5-[[(1R,2R,3R,4S,5R)-5-hydroxy-3-methoxy-7-oxabicyclo[2.2.1]heptan-2-yl]selanyl]-6-methoxy-7-oxabicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 14981289 |
| Molecular Formula | C14H22O6Se |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (1R,2S,4S,5S,6S)-5-[[(1R,2R,3R,4S,5R)-5-hydroxy-3-methoxy-7-oxabicyclo[2.2.1]heptan-2-yl]selanyl]-6-methoxy-7-oxabicyclo[2.2.1]heptan-2-ol |
| SMILES | CO[C@@H]1[C@H]2O[C@H](C[C@H]2O)[C@H]1[Se][C@@H]1[C@@H](OC)[C@@H]2O[C@H]1C[C@@H]2O |
| InChI | InChI=1S/C14H22O6Se/c1-17-11-9-5(15)3-7(19-9)13(11)21-14-8-4-6(16)10(20-8)12(14)18-2/h5-16H,3-4H2,1-2H3/t5-,6+,7-,8+,9+,10-,11-,12+,13-,14+ |
| InChIKey | VLCIUQZFSQGWDR-BUSYIMPOSA-N |
| XLogP | -0.64 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|