About lithium diethylaminomethanone
lithium diethylaminomethanone (PubChem CID 14982489) has the molecular formula C5H10LiNO
and a molecular weight of 107.08 g/mol. Its IUPAC name is lithium diethylaminomethanone.
Molecular Properties
| Compound Name | lithium diethylaminomethanone |
| PubChem CID | 14982489 |
| Molecular Formula | C5H10LiNO |
| Molecular Weight | 107.08 g/mol |
| Exact Mass | 107.09 |
| IUPAC Name | lithium diethylaminomethanone |
| SMILES | CCN([C-]=O)CC.[Li+] |
| InChI | InChI=1S/C5H10NO.Li/c1-3-6(4-2)5-7;/h3-4H2,1-2H3;/q-1;+1 |
| InChIKey | IAFDFBDZGBFEFO-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.08 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze lithium diethylaminomethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium diethylaminomethanone?
The IUPAC name of lithium diethylaminomethanone (CID 14982489) is lithium diethylaminomethanone.
What is the SMILES notation for lithium diethylaminomethanone?
The canonical SMILES for lithium diethylaminomethanone is CCN([C-]=O)CC.[Li+].
What is the InChIKey of lithium diethylaminomethanone?
The InChIKey is IAFDFBDZGBFEFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO.Li/c1-3-6(4-2)5-7;/h3-4H2,1-2H3;/q-1;+1.
What are the key properties of lithium diethylaminomethanone?
lithium diethylaminomethanone has a molecular weight of 107.08 g/mol, XLogP of -2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium diethylaminomethanone is sourced from PubChem (CID 14982489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).