C22H28O6 — CID 14986338
methyl 4-[6-(2,3-dimethoxyphenyl)hexoxy]-2-hydroxybenzoate (PubChem CID 14986338) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 4-[6-(2,3-dimethoxyphenyl)hexoxy]-2-hydroxybenzoate.
| Compound Name | methyl 4-[6-(2,3-dimethoxyphenyl)hexoxy]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 14986338 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl 4-[6-(2,3-dimethoxyphenyl)hexoxy]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(OCCCCCCc2cccc(OC)c2OC)cc1O |
| InChI | InChI=1S/C22H28O6/c1-25-20-11-8-10-16(21(20)26-2)9-6-4-5-7-14-28-17-12-13-18(19(23)15-17)22(24)27-3/h8,10-13,15,23H,4-7,9,14H2,1-3H3 |
| InChIKey | AETHZWGNFLCAKX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|