5-aminooxypentanoic acid

C5H11NO3 — CID 14989418

IUPAC5-aminooxypentanoic acid
SMILESNOCCCCC(=O)O
InChIInChI=1S/C5H11NO3/c6-9-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8)
InChIKeyLSJDOWHCQGJIIJ-UHFFFAOYSA-N
MW133.15 g/mol
LogP0.13
Rot. Bonds5

About 5-aminooxypentanoic acid

5-aminooxypentanoic acid (PubChem CID 14989418) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 5-aminooxypentanoic acid.

Molecular Properties

Compound Name5-aminooxypentanoic acid
PubChem CID14989418
Molecular FormulaC5H11NO3
Molecular Weight133.15 g/mol
Exact Mass133.07
IUPAC Name5-aminooxypentanoic acid
SMILESNOCCCCC(=O)O
InChIInChI=1S/C5H11NO3/c6-9-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8)
InChIKeyLSJDOWHCQGJIIJ-UHFFFAOYSA-N
XLogP0.13
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.15
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-aminooxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

19-aminooxynonadecanoic acid
CID 145081852
4-aminooxybutanoic acid;hydrochloride
CID 71361272
bis(ethane-1,2-diamine);hexanedioic acid
CID 88762987
6-[4-[6-[4-[6-[4-[6-[4-[6-[4-[6-[4-(5-carboxypentanoyloxy)butoxy]-6-oxohexanoyl]oxybutoxy]-6-oxohexanoyl]oxybutoxy]-6-oxohexanoyl]oxybutoxy]-6-oxohexanoyl]oxybutoxy]-6-oxohexanoyl]oxybutoxy]-6-oxohexanoic acid
CID 102514507
5-acetyloxypentanoic acid
CID 12642003
18-(9-carboxynonanoyloxy)octadecanoic acid
CID 87097649
8-(3-carboxypropoxy)octanoic acid
CID 154155651
8-hydroperoxyoctanoic acid
CID 91550474
22-acetyloxydocosanoic acid
CID 91481566
13-acetyloxytridecanoic acid
CID 10084643
6-[4-[4-[4-[4-[4-(3-carboxypropanoyloxy)butoxy]-4-oxobutanoyl]oxybutoxy]-4-oxobutanoyl]oxybutoxy]-6-oxohexanoic acid
CID 101096929
dodecanedioic acid;bis(tridecanedioic acid)
CID 87373965

Frequently Asked Questions

What is the IUPAC name of 5-aminooxypentanoic acid?
The IUPAC name of 5-aminooxypentanoic acid (CID 14989418) is 5-aminooxypentanoic acid.
What is the SMILES notation for 5-aminooxypentanoic acid?
The canonical SMILES for 5-aminooxypentanoic acid is NOCCCCC(=O)O.
What is the InChIKey of 5-aminooxypentanoic acid?
The InChIKey is LSJDOWHCQGJIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-9-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8).
What are the key properties of 5-aminooxypentanoic acid?
5-aminooxypentanoic acid has a molecular weight of 133.15 g/mol, XLogP of 0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminooxypentanoic acid is sourced from PubChem (CID 14989418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).