About 5-aminooxypentanoic acid
5-aminooxypentanoic acid (PubChem CID 14989418) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 5-aminooxypentanoic acid.
Molecular Properties
| Compound Name | 5-aminooxypentanoic acid |
| PubChem CID | 14989418 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 5-aminooxypentanoic acid |
| SMILES | NOCCCCC(=O)O |
| InChI | InChI=1S/C5H11NO3/c6-9-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8) |
| InChIKey | LSJDOWHCQGJIIJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-aminooxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminooxypentanoic acid?
The IUPAC name of 5-aminooxypentanoic acid (CID 14989418) is 5-aminooxypentanoic acid.
What is the SMILES notation for 5-aminooxypentanoic acid?
The canonical SMILES for 5-aminooxypentanoic acid is NOCCCCC(=O)O.
What is the InChIKey of 5-aminooxypentanoic acid?
The InChIKey is LSJDOWHCQGJIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-9-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8).
What are the key properties of 5-aminooxypentanoic acid?
5-aminooxypentanoic acid has a molecular weight of 133.15 g/mol, XLogP of 0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminooxypentanoic acid is sourced from PubChem (CID 14989418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).